C15H20F3N3 — CID 102993184
4-[3-(dimethylamino)propyl-ethylamino]-2-(trifluoromethyl)benzonitrile (PubChem CID 102993184) has the molecular formula C15H20F3N3 and a molecular weight of 299.34 g/mol. Its IUPAC name is 4-[3-(dimethylamino)propyl-ethylamino]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-(dimethylamino)propyl-ethylamino]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 102993184 |
| Molecular Formula | C15H20F3N3 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 4-[3-(dimethylamino)propyl-ethylamino]-2-(trifluoromethyl)benzonitrile |
| SMILES | CCN(CCCN(C)C)c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H20F3N3/c1-4-21(9-5-8-20(2)3)13-7-6-12(11-19)14(10-13)15(16,17)18/h6-7,10H,4-5,8-9H2,1-3H3 |
| InChIKey | QUXANZNDSHSIQV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |