C12H13F3N2S — CID 112698451
4-[methyl(2-methylsulfanylethyl)amino]-2-(trifluoromethyl)benzonitrile (PubChem CID 112698451) has the molecular formula C12H13F3N2S and a molecular weight of 274.31 g/mol. Its IUPAC name is 4-[methyl(2-methylsulfanylethyl)amino]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[methyl(2-methylsulfanylethyl)amino]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 112698451 |
| Molecular Formula | C12H13F3N2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 4-[methyl(2-methylsulfanylethyl)amino]-2-(trifluoromethyl)benzonitrile |
| SMILES | CSCCN(C)c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3N2S/c1-17(5-6-18-2)10-4-3-9(8-16)11(7-10)12(13,14)15/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | BMRBDXSUEPFORT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |