C15H17F3N2O — CID 11289510
4-[2,2-dimethylpropyl(2-oxoethyl)amino]-2-(trifluoromethyl)benzonitrile (PubChem CID 11289510) has the molecular formula C15H17F3N2O and a molecular weight of 298.31 g/mol. Its IUPAC name is 4-[2,2-dimethylpropyl(2-oxoethyl)amino]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[2,2-dimethylpropyl(2-oxoethyl)amino]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 11289510 |
| Molecular Formula | C15H17F3N2O |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 4-[2,2-dimethylpropyl(2-oxoethyl)amino]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC(C)(C)CN(CC=O)c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H17F3N2O/c1-14(2,3)10-20(6-7-21)12-5-4-11(9-19)13(8-12)15(16,17)18/h4-5,7-8H,6,10H2,1-3H3 |
| InChIKey | MPKNIFAJTWFTGP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|