C15H14F6N2 — CID 87471181
4-[3-methylbut-2-enyl(2,2,2-trifluoroethyl)amino]-2-(trifluoromethyl)benzonitrile (PubChem CID 87471181) has the molecular formula C15H14F6N2 and a molecular weight of 336.28 g/mol. Its IUPAC name is 4-[3-methylbut-2-enyl(2,2,2-trifluoroethyl)amino]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-methylbut-2-enyl(2,2,2-trifluoroethyl)amino]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 87471181 |
| Molecular Formula | C15H14F6N2 |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 4-[3-methylbut-2-enyl(2,2,2-trifluoroethyl)amino]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC(C)=CCN(CC(F)(F)F)c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H14F6N2/c1-10(2)5-6-23(9-14(16,17)18)12-4-3-11(8-22)13(7-12)15(19,20)21/h3-5,7H,6,9H2,1-2H3 |
| InChIKey | URJKIZXERKWKPD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|