C12H10F6N4 — CID 143366948
2-[4-cyano-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)anilino]ethanimidamide (PubChem CID 143366948) has the molecular formula C12H10F6N4 and a molecular weight of 324.23 g/mol. Its IUPAC name is 2-[4-cyano-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)anilino]ethanimidamide.
| Compound Name | 2-[4-cyano-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)anilino]ethanimidamide |
|---|---|
| PubChem CID | 143366948 |
| Molecular Formula | C12H10F6N4 |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 2-[4-cyano-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)anilino]ethanimidamide |
| SMILES | [H]/N=C(\N)CN(CC(F)(F)F)c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H10F6N4/c13-11(14,15)6-22(5-10(20)21)8-2-1-7(4-19)9(3-8)12(16,17)18/h1-3H,5-6H2,(H3,20,21) |
| InChIKey | YQJQNRFRKAJNCK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 76.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|