C19H17F4N3O — CID 11668012
2-[4-cyano-N-ethyl-3-(trifluoromethyl)anilino]-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 11668012) has the molecular formula C19H17F4N3O and a molecular weight of 379.36 g/mol. Its IUPAC name is 2-[4-cyano-N-ethyl-3-(trifluoromethyl)anilino]-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[4-cyano-N-ethyl-3-(trifluoromethyl)anilino]-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 11668012 |
| Molecular Formula | C19H17F4N3O |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 2-[4-cyano-N-ethyl-3-(trifluoromethyl)anilino]-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | CCN(CC(=O)NCc1ccc(F)cc1)c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17F4N3O/c1-2-26(12-18(27)25-11-13-3-6-15(20)7-4-13)16-8-5-14(10-24)17(9-16)19(21,22)23/h3-9H,2,11-12H2,1H3,(H,25,27) |
| InChIKey | XUPGAFNOEBLUCV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |