C18H17F2N3O — CID 133400790
2-(2-cyano-N-ethyl-4-fluoroanilino)-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 133400790) has the molecular formula C18H17F2N3O and a molecular weight of 329.35 g/mol. Its IUPAC name is 2-(2-cyano-N-ethyl-4-fluoroanilino)-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-(2-cyano-N-ethyl-4-fluoroanilino)-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 133400790 |
| Molecular Formula | C18H17F2N3O |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-(2-cyano-N-ethyl-4-fluoroanilino)-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | CCN(CC(=O)NCc1ccc(F)cc1)c1ccc(F)cc1C#N |
| InChI | InChI=1S/C18H17F2N3O/c1-2-23(17-8-7-16(20)9-14(17)10-21)12-18(24)22-11-13-3-5-15(19)6-4-13/h3-9H,2,11-12H2,1H3,(H,22,24) |
| InChIKey | PLEJYDPEUOCQHT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |