C20H23FN4O — CID 78839329
1-(2-cyano-4-fluorophenyl)-3-[[4-(diethylaminomethyl)phenyl]methyl]urea (PubChem CID 78839329) has the molecular formula C20H23FN4O and a molecular weight of 354.43 g/mol. Its IUPAC name is 1-(2-cyano-4-fluorophenyl)-3-[[4-(diethylaminomethyl)phenyl]methyl]urea.
| Compound Name | 1-(2-cyano-4-fluorophenyl)-3-[[4-(diethylaminomethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 78839329 |
| Molecular Formula | C20H23FN4O |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 1-(2-cyano-4-fluorophenyl)-3-[[4-(diethylaminomethyl)phenyl]methyl]urea |
| SMILES | CCN(CC)Cc1ccc(CNC(=O)Nc2ccc(F)cc2C#N)cc1 |
| InChI | InChI=1S/C20H23FN4O/c1-3-25(4-2)14-16-7-5-15(6-8-16)13-23-20(26)24-19-10-9-18(21)11-17(19)12-22/h5-11H,3-4,13-14H2,1-2H3,(H2,23,24,26) |
| InChIKey | NLFRJNDRNJYRCY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |