C16H13ClF3N5O3 — CID 167284258
(2S)-3-[4-[(2-chloroacetyl)amino]pyrazol-1-yl]-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxypropanamide (PubChem CID 167284258) has the molecular formula C16H13ClF3N5O3 and a molecular weight of 415.76 g/mol. Its IUPAC name is (2S)-3-[4-[(2-chloroacetyl)amino]pyrazol-1-yl]-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxypropanamide.
| Compound Name | (2S)-3-[4-[(2-chloroacetyl)amino]pyrazol-1-yl]-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 167284258 |
| Molecular Formula | C16H13ClF3N5O3 |
| Molecular Weight | 415.76 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | (2S)-3-[4-[(2-chloroacetyl)amino]pyrazol-1-yl]-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxypropanamide |
| SMILES | N#Cc1ccc(NC(=O)[C@@H](O)Cn2cc(NC(=O)CCl)cn2)cc1C(F)(F)F |
| InChI | InChI=1S/C16H13ClF3N5O3/c17-4-14(27)23-11-6-22-25(7-11)8-13(26)15(28)24-10-2-1-9(5-21)12(3-10)16(18,19)20/h1-3,6-7,13,26H,4,8H2,(H,23,27)(H,24,28)/t13-/m0/s1 |
| InChIKey | WZCZZICEUVTDIV-ZDUSSCGKSA-N |
| XLogP | 1.95 |
| TPSA | 120.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.76 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|