C15H12F4N4O — CID 153366055
(2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(4-fluoropyrazol-1-yl)-2-methylpropanamide (PubChem CID 153366055) has the molecular formula C15H12F4N4O and a molecular weight of 340.28 g/mol. Its IUPAC name is (2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(4-fluoropyrazol-1-yl)-2-methylpropanamide.
| Compound Name | (2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(4-fluoropyrazol-1-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 153366055 |
| Molecular Formula | C15H12F4N4O |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | (2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(4-fluoropyrazol-1-yl)-2-methylpropanamide |
| SMILES | C[C@@H](Cn1cc(F)cn1)C(=O)Nc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H12F4N4O/c1-9(7-23-8-11(16)6-21-23)14(24)22-12-3-2-10(5-20)13(4-12)15(17,18)19/h2-4,6,8-9H,7H2,1H3,(H,22,24)/t9-/m0/s1 |
| InChIKey | KETQDHYSNYBDHH-VIFPVBQESA-N |
| XLogP | 3.19 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |