C16H14F3N5 — CID 174163143
1-[3-[4-cyano-3-(trifluoromethyl)anilino]-2-methylpropyl]pyrazole-4-carbonitrile (PubChem CID 174163143) has the molecular formula C16H14F3N5 and a molecular weight of 333.32 g/mol. Its IUPAC name is 1-[3-[4-cyano-3-(trifluoromethyl)anilino]-2-methylpropyl]pyrazole-4-carbonitrile.
| Compound Name | 1-[3-[4-cyano-3-(trifluoromethyl)anilino]-2-methylpropyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 174163143 |
| Molecular Formula | C16H14F3N5 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 1-[3-[4-cyano-3-(trifluoromethyl)anilino]-2-methylpropyl]pyrazole-4-carbonitrile |
| SMILES | CC(CNc1ccc(C#N)c(C(F)(F)F)c1)Cn1cc(C#N)cn1 |
| InChI | InChI=1S/C16H14F3N5/c1-11(9-24-10-12(5-20)8-23-24)7-22-14-3-2-13(6-21)15(4-14)16(17,18)19/h2-4,8,10-11,22H,7,9H2,1H3 |
| InChIKey | VZSFYQBEEKQJQH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |