C24H14ClF3N2O2 — CID 25094855
N-(3-chloro-4-cyanophenyl)-2-hydroxy-2-phenyl-4-[4-(trifluoromethyl)phenyl]but-3-ynamide (PubChem CID 25094855) has the molecular formula C24H14ClF3N2O2 and a molecular weight of 454.84 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)-2-hydroxy-2-phenyl-4-[4-(trifluoromethyl)phenyl]but-3-ynamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)-2-hydroxy-2-phenyl-4-[4-(trifluoromethyl)phenyl]but-3-ynamide |
|---|---|
| PubChem CID | 25094855 |
| Molecular Formula | C24H14ClF3N2O2 |
| Molecular Weight | 454.84 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)-2-hydroxy-2-phenyl-4-[4-(trifluoromethyl)phenyl]but-3-ynamide |
| SMILES | N#Cc1ccc(NC(=O)C(O)(C#Cc2ccc(C(F)(F)F)cc2)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C24H14ClF3N2O2/c25-21-14-20(11-8-17(21)15-29)30-22(31)23(32,18-4-2-1-3-5-18)13-12-16-6-9-19(10-7-16)24(26,27)28/h1-11,14,32H,(H,30,31) |
| InChIKey | TUDRVZXXNIJNPZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.84 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|