C24H19ClN2O3 — CID 143706351
N-(3-chloro-4-cyanophenyl)-2-hydroxy-4-[2-(hydroxymethyl)phenyl]-2-phenylbut-3-enamide (PubChem CID 143706351) has the molecular formula C24H19ClN2O3 and a molecular weight of 418.88 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)-2-hydroxy-4-[2-(hydroxymethyl)phenyl]-2-phenylbut-3-enamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)-2-hydroxy-4-[2-(hydroxymethyl)phenyl]-2-phenylbut-3-enamide |
|---|---|
| PubChem CID | 143706351 |
| Molecular Formula | C24H19ClN2O3 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)-2-hydroxy-4-[2-(hydroxymethyl)phenyl]-2-phenylbut-3-enamide |
| SMILES | N#Cc1ccc(NC(=O)C(O)(C=Cc2ccccc2CO)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C24H19ClN2O3/c25-22-14-21(11-10-18(22)15-26)27-23(29)24(30,20-8-2-1-3-9-20)13-12-17-6-4-5-7-19(17)16-28/h1-14,28,30H,16H2,(H,27,29) |
| InChIKey | CNRLSZPQEMUTGT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |