C17H22ClN3O — CID 9265066
N-(3-chloro-4-cyanophenyl)-2-(cyclooctylamino)acetamide (PubChem CID 9265066) has the molecular formula C17H22ClN3O and a molecular weight of 319.84 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)-2-(cyclooctylamino)acetamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)-2-(cyclooctylamino)acetamide |
|---|---|
| PubChem CID | 9265066 |
| Molecular Formula | C17H22ClN3O |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)-2-(cyclooctylamino)acetamide |
| SMILES | N#Cc1ccc(NC(=O)CNC2CCCCCCC2)cc1Cl |
| InChI | InChI=1S/C17H22ClN3O/c18-16-10-15(9-8-13(16)11-19)21-17(22)12-20-14-6-4-2-1-3-5-7-14/h8-10,14,20H,1-7,12H2,(H,21,22) |
| InChIKey | XQRQKHRUUDRAHD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |