C18H20ClN3O4 — CID 55459650
[2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-acetamido-2-cyclopentylacetate (PubChem CID 55459650) has the molecular formula C18H20ClN3O4 and a molecular weight of 377.83 g/mol. Its IUPAC name is [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-acetamido-2-cyclopentylacetate.
| Compound Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-acetamido-2-cyclopentylacetate |
|---|---|
| PubChem CID | 55459650 |
| Molecular Formula | C18H20ClN3O4 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-acetamido-2-cyclopentylacetate |
| SMILES | CC(=O)NC(C(=O)OCC(=O)Nc1ccc(C#N)c(Cl)c1)C1CCCC1 |
| InChI | InChI=1S/C18H20ClN3O4/c1-11(23)21-17(12-4-2-3-5-12)18(25)26-10-16(24)22-14-7-6-13(9-20)15(19)8-14/h6-8,12,17H,2-5,10H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | AIWUTYXABAUTMJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |