C16H15ClF2N2O3 — CID 51944880
1-[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]-3-[4-(difluoromethoxy)phenyl]urea (PubChem CID 51944880) has the molecular formula C16H15ClF2N2O3 and a molecular weight of 356.76 g/mol. Its IUPAC name is 1-[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]-3-[4-(difluoromethoxy)phenyl]urea.
| Compound Name | 1-[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]-3-[4-(difluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 51944880 |
| Molecular Formula | C16H15ClF2N2O3 |
| Molecular Weight | 356.76 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 1-[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]-3-[4-(difluoromethoxy)phenyl]urea |
| SMILES | O=C(NC[C@@H](O)c1cccc(Cl)c1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H15ClF2N2O3/c17-11-3-1-2-10(8-11)14(22)9-20-16(23)21-12-4-6-13(7-5-12)24-15(18)19/h1-8,14-15,22H,9H2,(H2,20,21,23)/t14-/m1/s1 |
| InChIKey | CSQUBEJAVWWBGX-CQSZACIVSA-N |
| XLogP | 3.80 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.76 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |