C17H16F4N2O3 — CID 59649481
1-[4-(difluoromethoxy)phenyl]-3-[2-[3-(difluoromethoxy)phenyl]ethyl]urea (PubChem CID 59649481) has the molecular formula C17H16F4N2O3 and a molecular weight of 372.32 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-3-[2-[3-(difluoromethoxy)phenyl]ethyl]urea.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-3-[2-[3-(difluoromethoxy)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 59649481 |
| Molecular Formula | C17H16F4N2O3 |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-3-[2-[3-(difluoromethoxy)phenyl]ethyl]urea |
| SMILES | O=C(NCCc1cccc(OC(F)F)c1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H16F4N2O3/c18-15(19)25-13-6-4-12(5-7-13)23-17(24)22-9-8-11-2-1-3-14(10-11)26-16(20)21/h1-7,10,15-16H,8-9H2,(H2,22,23,24) |
| InChIKey | BGIXZCSMOYXAIT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |