C14H14F2N2O3S — CID 95774476
1-[4-(difluoromethoxy)phenyl]-3-[(2S)-2-hydroxy-2-thiophen-3-ylethyl]urea (PubChem CID 95774476) has the molecular formula C14H14F2N2O3S and a molecular weight of 328.34 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-3-[(2S)-2-hydroxy-2-thiophen-3-ylethyl]urea.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-3-[(2S)-2-hydroxy-2-thiophen-3-ylethyl]urea |
|---|---|
| PubChem CID | 95774476 |
| Molecular Formula | C14H14F2N2O3S |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-3-[(2S)-2-hydroxy-2-thiophen-3-ylethyl]urea |
| SMILES | O=C(NC[C@@H](O)c1ccsc1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C14H14F2N2O3S/c15-13(16)21-11-3-1-10(2-4-11)18-14(20)17-7-12(19)9-5-6-22-8-9/h1-6,8,12-13,19H,7H2,(H2,17,18,20)/t12-/m1/s1 |
| InChIKey | VUELPLLENQGSPG-GFCCVEGCSA-N |
| XLogP | 3.20 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |