C12H12ClN3O2S — CID 94024697
1-[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 94024697) has the molecular formula C12H12ClN3O2S and a molecular weight of 297.77 g/mol. Its IUPAC name is 1-[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 94024697 |
| Molecular Formula | C12H12ClN3O2S |
| Molecular Weight | 297.77 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 1-[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | O=C(NC[C@@H](O)c1cccc(Cl)c1)Nc1nccs1 |
| InChI | InChI=1S/C12H12ClN3O2S/c13-9-3-1-2-8(6-9)10(17)7-15-11(18)16-12-14-4-5-19-12/h1-6,10,17H,7H2,(H2,14,15,16,18)/t10-/m1/s1 |
| InChIKey | LVMQDOFFIHUOKF-SNVBAGLBSA-N |
| XLogP | 2.65 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.77 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |