C18H19ClN2O3 — CID 95775664
N-[(2S)-2-(2-chlorophenyl)-2-hydroxyethyl]-N'-(2,5-dimethylphenyl)oxamide (PubChem CID 95775664) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is N-[(2S)-2-(2-chlorophenyl)-2-hydroxyethyl]-N'-(2,5-dimethylphenyl)oxamide.
| Compound Name | N-[(2S)-2-(2-chlorophenyl)-2-hydroxyethyl]-N'-(2,5-dimethylphenyl)oxamide |
|---|---|
| PubChem CID | 95775664 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-[(2S)-2-(2-chlorophenyl)-2-hydroxyethyl]-N'-(2,5-dimethylphenyl)oxamide |
| SMILES | Cc1ccc(C)c(NC(=O)C(=O)NC[C@@H](O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C18H19ClN2O3/c1-11-7-8-12(2)15(9-11)21-18(24)17(23)20-10-16(22)13-5-3-4-6-14(13)19/h3-9,16,22H,10H2,1-2H3,(H,20,23)(H,21,24)/t16-/m1/s1 |
| InChIKey | NALIIYJZKVWOPH-MRXNPFEDSA-N |
| XLogP | 2.75 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|