C19H22N2O3S — CID 90582021
N'-(2,5-dimethylphenyl)-N-[2-hydroxy-2-(4-methylsulfanylphenyl)ethyl]oxamide (PubChem CID 90582021) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is N'-(2,5-dimethylphenyl)-N-[2-hydroxy-2-(4-methylsulfanylphenyl)ethyl]oxamide.
| Compound Name | N'-(2,5-dimethylphenyl)-N-[2-hydroxy-2-(4-methylsulfanylphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 90582021 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N'-(2,5-dimethylphenyl)-N-[2-hydroxy-2-(4-methylsulfanylphenyl)ethyl]oxamide |
| SMILES | CSc1ccc(C(O)CNC(=O)C(=O)Nc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C19H22N2O3S/c1-12-4-5-13(2)16(10-12)21-19(24)18(23)20-11-17(22)14-6-8-15(25-3)9-7-14/h4-10,17,22H,11H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | MZJREUGLGOTCGK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|