C11H15F2NO3 — CID 82722763
1-(2,6-difluorophenyl)-2-(2-methoxyethoxyamino)ethanol (PubChem CID 82722763) has the molecular formula C11H15F2NO3 and a molecular weight of 247.24 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-2-(2-methoxyethoxyamino)ethanol.
| Compound Name | 1-(2,6-difluorophenyl)-2-(2-methoxyethoxyamino)ethanol |
|---|---|
| PubChem CID | 82722763 |
| Molecular Formula | C11H15F2NO3 |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 1-(2,6-difluorophenyl)-2-(2-methoxyethoxyamino)ethanol |
| SMILES | COCCONCC(O)c1c(F)cccc1F |
| InChI | InChI=1S/C11H15F2NO3/c1-16-5-6-17-14-7-10(15)11-8(12)3-2-4-9(11)13/h2-4,10,14-15H,5-7H2,1H3 |
| InChIKey | ADYVMWMSPGEMJE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|