C11H11Cl2F3N2O2 — CID 111427361
1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 111427361) has the molecular formula C11H11Cl2F3N2O2 and a molecular weight of 331.12 g/mol. Its IUPAC name is 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 111427361 |
| Molecular Formula | C11H11Cl2F3N2O2 |
| Molecular Weight | 331.12 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(O)c1cc(Cl)cc(Cl)c1)NCC(F)(F)F |
| InChI | InChI=1S/C11H11Cl2F3N2O2/c12-7-1-6(2-8(13)3-7)9(19)4-17-10(20)18-5-11(14,15)16/h1-3,9,19H,4-5H2,(H2,17,18,20) |
| InChIKey | PILOBXHEPGSSNW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.12 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |