C10H10Cl2F3NO — CID 61044931
2-(3,5-dichlorophenyl)-2-(2,2,2-trifluoroethylamino)ethanol (PubChem CID 61044931) has the molecular formula C10H10Cl2F3NO and a molecular weight of 288.10 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-2-(2,2,2-trifluoroethylamino)ethanol.
| Compound Name | 2-(3,5-dichlorophenyl)-2-(2,2,2-trifluoroethylamino)ethanol |
|---|---|
| PubChem CID | 61044931 |
| Molecular Formula | C10H10Cl2F3NO |
| Molecular Weight | 288.10 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-2-(2,2,2-trifluoroethylamino)ethanol |
| SMILES | OCC(NCC(F)(F)F)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H10Cl2F3NO/c11-7-1-6(2-8(12)3-7)9(4-17)16-5-10(13,14)15/h1-3,9,16-17H,4-5H2 |
| InChIKey | CVLVPUDURZTXEY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.10 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |