C11H13Cl2NO — CID 61056839
2-(cyclopropylamino)-2-(3,5-dichlorophenyl)ethanol (PubChem CID 61056839) has the molecular formula C11H13Cl2NO and a molecular weight of 246.14 g/mol. Its IUPAC name is 2-(cyclopropylamino)-2-(3,5-dichlorophenyl)ethanol.
| Compound Name | 2-(cyclopropylamino)-2-(3,5-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 61056839 |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2-(cyclopropylamino)-2-(3,5-dichlorophenyl)ethanol |
| SMILES | OCC(NC1CC1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C11H13Cl2NO/c12-8-3-7(4-9(13)5-8)11(6-15)14-10-1-2-10/h3-5,10-11,14-15H,1-2,6H2 |
| InChIKey | SDBZNHJNFFZDLM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |