C11H15Cl2FN2O — CID 141286037
2-(4-amino-3-chloro-5-fluorophenyl)-2-(cyclopropylamino)ethanol;hydrochloride (PubChem CID 141286037) has the molecular formula C11H15Cl2FN2O and a molecular weight of 281.16 g/mol. Its IUPAC name is 2-(4-amino-3-chloro-5-fluorophenyl)-2-(cyclopropylamino)ethanol;hydrochloride.
| Compound Name | 2-(4-amino-3-chloro-5-fluorophenyl)-2-(cyclopropylamino)ethanol;hydrochloride |
|---|---|
| PubChem CID | 141286037 |
| Molecular Formula | C11H15Cl2FN2O |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 2-(4-amino-3-chloro-5-fluorophenyl)-2-(cyclopropylamino)ethanol;hydrochloride |
| SMILES | Cl.Nc1c(F)cc(C(CO)NC2CC2)cc1Cl |
| InChI | InChI=1S/C11H14ClFN2O.ClH/c12-8-3-6(4-9(13)11(8)14)10(5-16)15-7-1-2-7;/h3-4,7,10,15-16H,1-2,5,14H2;1H |
| InChIKey | INVJPGJLOHQIGN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|