C14H18BrF3N2O — CID 141286035
2-[4-amino-3-bromo-5-(trifluoromethyl)phenyl]-2-(cyclopentylamino)ethanol (PubChem CID 141286035) has the molecular formula C14H18BrF3N2O and a molecular weight of 367.21 g/mol. Its IUPAC name is 2-[4-amino-3-bromo-5-(trifluoromethyl)phenyl]-2-(cyclopentylamino)ethanol.
| Compound Name | 2-[4-amino-3-bromo-5-(trifluoromethyl)phenyl]-2-(cyclopentylamino)ethanol |
|---|---|
| PubChem CID | 141286035 |
| Molecular Formula | C14H18BrF3N2O |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 2-[4-amino-3-bromo-5-(trifluoromethyl)phenyl]-2-(cyclopentylamino)ethanol |
| SMILES | Nc1c(Br)cc(C(CO)NC2CCCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H18BrF3N2O/c15-11-6-8(5-10(13(11)19)14(16,17)18)12(7-21)20-9-3-1-2-4-9/h5-6,9,12,20-21H,1-4,7,19H2 |
| InChIKey | BXMDIXZURKUADM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|