C12H18Cl2N2O — CID 70448971
2-(4-amino-3,5-dichlorophenyl)-2-(tert-butylamino)ethanol (PubChem CID 70448971) has the molecular formula C12H18Cl2N2O and a molecular weight of 277.20 g/mol. Its IUPAC name is 2-(4-amino-3,5-dichlorophenyl)-2-(tert-butylamino)ethanol.
| Compound Name | 2-(4-amino-3,5-dichlorophenyl)-2-(tert-butylamino)ethanol |
|---|---|
| PubChem CID | 70448971 |
| Molecular Formula | C12H18Cl2N2O |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2-(4-amino-3,5-dichlorophenyl)-2-(tert-butylamino)ethanol |
| SMILES | CC(C)(C)NC(CO)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C12H18Cl2N2O/c1-12(2,3)16-10(6-17)7-4-8(13)11(15)9(14)5-7/h4-5,10,16-17H,6,15H2,1-3H3 |
| InChIKey | ZHWHXGDAISTILR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|