C16H24ClNO3 — CID 110931236
N-[2-(4-chlorophenyl)-2-hydroxyethyl]-2-(3-methylbutoxy)propanamide (PubChem CID 110931236) has the molecular formula C16H24ClNO3 and a molecular weight of 313.82 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-hydroxyethyl]-2-(3-methylbutoxy)propanamide.
| Compound Name | N-[2-(4-chlorophenyl)-2-hydroxyethyl]-2-(3-methylbutoxy)propanamide |
|---|---|
| PubChem CID | 110931236 |
| Molecular Formula | C16H24ClNO3 |
| Molecular Weight | 313.82 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-hydroxyethyl]-2-(3-methylbutoxy)propanamide |
| SMILES | CC(C)CCOC(C)C(=O)NCC(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H24ClNO3/c1-11(2)8-9-21-12(3)16(20)18-10-15(19)13-4-6-14(17)7-5-13/h4-7,11-12,15,19H,8-10H2,1-3H3,(H,18,20) |
| InChIKey | HDOQKPLSTYKLFE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.82 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |