C17H26ClNO2 — CID 86076853
N-[2-(4-chlorophenyl)-2-hydroxyethyl]nonanamide (PubChem CID 86076853) has the molecular formula C17H26ClNO2 and a molecular weight of 311.85 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-hydroxyethyl]nonanamide.
| Compound Name | N-[2-(4-chlorophenyl)-2-hydroxyethyl]nonanamide |
|---|---|
| PubChem CID | 86076853 |
| Molecular Formula | C17H26ClNO2 |
| Molecular Weight | 311.85 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-hydroxyethyl]nonanamide |
| SMILES | CCCCCCCCC(=O)NCC(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H26ClNO2/c1-2-3-4-5-6-7-8-17(21)19-13-16(20)14-9-11-15(18)12-10-14/h9-12,16,20H,2-8,13H2,1H3,(H,19,21) |
| InChIKey | MEJCJIFWODKUED-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.85 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|