C24H40BNO4 — CID 177325852
N-[2-hydroxy-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]decanamide (PubChem CID 177325852) has the molecular formula C24H40BNO4 and a molecular weight of 417.40 g/mol. Its IUPAC name is N-[2-hydroxy-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]decanamide.
| Compound Name | N-[2-hydroxy-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]decanamide |
|---|---|
| PubChem CID | 177325852 |
| Molecular Formula | C24H40BNO4 |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.31 |
| IUPAC Name | N-[2-hydroxy-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]decanamide |
| SMILES | CCCCCCCCCC(=O)NCC(O)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C24H40BNO4/c1-6-7-8-9-10-11-12-13-22(28)26-18-21(27)19-14-16-20(17-15-19)25-29-23(2,3)24(4,5)30-25/h14-17,21,27H,6-13,18H2,1-5H3,(H,26,28) |
| InChIKey | SUUCSFTZHGIRDJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|