C25H43BN2O8 — CID 177325847
3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-N-[2-hydroxy-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]propanamide (PubChem CID 177325847) has the molecular formula C25H43BN2O8 and a molecular weight of 510.44 g/mol. Its IUPAC name is 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-N-[2-hydroxy-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]propanamide.
| Compound Name | 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-N-[2-hydroxy-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]propanamide |
|---|---|
| PubChem CID | 177325847 |
| Molecular Formula | C25H43BN2O8 |
| Molecular Weight | 510.44 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-N-[2-hydroxy-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]propanamide |
| SMILES | CC1(C)OB(c2ccc(C(O)CNC(=O)CCOCCOCCOCCOCCN)cc2)OC1(C)C |
| InChI | InChI=1S/C25H43BN2O8/c1-24(2)25(3,4)36-26(35-24)21-7-5-20(6-8-21)22(29)19-28-23(30)9-11-31-13-15-33-17-18-34-16-14-32-12-10-27/h5-8,22,29H,9-19,27H2,1-4H3,(H,28,30) |
| InChIKey | NGMPXBODHLBQMA-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 130.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.44 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|