C25H42BNO8 — CID 102235744
[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl 3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethylamino]propanoate (PubChem CID 102235744) has the molecular formula C25H42BNO8 and a molecular weight of 495.42 g/mol. Its IUPAC name is [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl 3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethylamino]propanoate.
| Compound Name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl 3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethylamino]propanoate |
|---|---|
| PubChem CID | 102235744 |
| Molecular Formula | C25H42BNO8 |
| Molecular Weight | 495.42 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl 3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethylamino]propanoate |
| SMILES | COCCOCCOCCOCCNCCC(=O)OCc1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C25H42BNO8/c1-24(2)25(3,4)35-26(34-24)22-8-6-21(7-9-22)20-33-23(28)10-11-27-12-13-30-16-17-32-19-18-31-15-14-29-5/h6-9,27H,10-20H2,1-5H3 |
| InChIKey | KMEZJDWICBJBBH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|