C11H25NO3 — CID 156842187
N-(5,6-dihydroxyhexyl)propanamide;ethane (PubChem CID 156842187) has the molecular formula C11H25NO3 and a molecular weight of 219.32 g/mol. Its IUPAC name is N-(5,6-dihydroxyhexyl)propanamide;ethane.
| Compound Name | N-(5,6-dihydroxyhexyl)propanamide;ethane |
|---|---|
| PubChem CID | 156842187 |
| Molecular Formula | C11H25NO3 |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | N-(5,6-dihydroxyhexyl)propanamide;ethane |
| SMILES | CC.CCC(=O)NCCCCC(O)CO |
| InChI | InChI=1S/C9H19NO3.C2H6/c1-2-9(13)10-6-4-3-5-8(12)7-11;1-2/h8,11-12H,2-7H2,1H3,(H,10,13);1-2H3 |
| InChIKey | FSHUMDCVDXQYJH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|