C9H21N2O4P — CID 21484023
[1-(carbamoylamino)-2-ethylhexyl]phosphonic acid (PubChem CID 21484023) has the molecular formula C9H21N2O4P and a molecular weight of 252.25 g/mol. Its IUPAC name is [1-(carbamoylamino)-2-ethylhexyl]phosphonic acid.
| Compound Name | [1-(carbamoylamino)-2-ethylhexyl]phosphonic acid |
|---|---|
| PubChem CID | 21484023 |
| Molecular Formula | C9H21N2O4P |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | [1-(carbamoylamino)-2-ethylhexyl]phosphonic acid |
| SMILES | CCCCC(CC)C(NC(N)=O)P(=O)(O)O |
| InChI | InChI=1S/C9H21N2O4P/c1-3-5-6-7(4-2)8(11-9(10)12)16(13,14)15/h7-8H,3-6H2,1-2H3,(H3,10,11,12)(H2,13,14,15) |
| InChIKey | NAKJZIGFDURWJE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|