C16H34N2O3 — CID 151957297
2-(2,2-diethoxyethyl)nonylurea (PubChem CID 151957297) has the molecular formula C16H34N2O3 and a molecular weight of 302.46 g/mol. Its IUPAC name is 2-(2,2-diethoxyethyl)nonylurea.
| Compound Name | 2-(2,2-diethoxyethyl)nonylurea |
|---|---|
| PubChem CID | 151957297 |
| Molecular Formula | C16H34N2O3 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | 2-(2,2-diethoxyethyl)nonylurea |
| SMILES | CCCCCCCC(CNC(N)=O)CC(OCC)OCC |
| InChI | InChI=1S/C16H34N2O3/c1-4-7-8-9-10-11-14(13-18-16(17)19)12-15(20-5-2)21-6-3/h14-15H,4-13H2,1-3H3,(H3,17,18,19) |
| InChIKey | TXXGEZQLKJBJFN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|