About 2-ethoxyoctanamide
2-ethoxyoctanamide (PubChem CID 174492663) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is 2-ethoxyoctanamide.
Molecular Properties
| Compound Name | 2-ethoxyoctanamide |
| PubChem CID | 174492663 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 2-ethoxyoctanamide |
| SMILES | CCCCCCC(OCC)C(N)=O |
| InChI | InChI=1S/C10H21NO2/c1-3-5-6-7-8-9(10(11)12)13-4-2/h9H,3-8H2,1-2H3,(H2,11,12) |
| InChIKey | JGAUNXOPGRRSNE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyoctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyoctanamide?
The IUPAC name of 2-ethoxyoctanamide (CID 174492663) is 2-ethoxyoctanamide.
What is the SMILES notation for 2-ethoxyoctanamide?
The canonical SMILES for 2-ethoxyoctanamide is CCCCCCC(OCC)C(N)=O.
What is the InChIKey of 2-ethoxyoctanamide?
The InChIKey is JGAUNXOPGRRSNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO2/c1-3-5-6-7-8-9(10(11)12)13-4-2/h9H,3-8H2,1-2H3,(H2,11,12).
What are the key properties of 2-ethoxyoctanamide?
2-ethoxyoctanamide has a molecular weight of 187.28 g/mol, XLogP of 1.85, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyoctanamide is sourced from PubChem (CID 174492663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).