C13H30N2 — CID 135223941
(2S)-1-N-propyldecane-1,2-diamine (PubChem CID 135223941) has the molecular formula C13H30N2 and a molecular weight of 214.40 g/mol. Its IUPAC name is (2S)-1-N-propyldecane-1,2-diamine.
| Compound Name | (2S)-1-N-propyldecane-1,2-diamine |
|---|---|
| PubChem CID | 135223941 |
| Molecular Formula | C13H30N2 |
| Molecular Weight | 214.40 g/mol |
| Exact Mass | 214.24 |
| IUPAC Name | (2S)-1-N-propyldecane-1,2-diamine |
| SMILES | CCCCCCCC[C@H](N)CNCCC |
| InChI | InChI=1S/C13H30N2/c1-3-5-6-7-8-9-10-13(14)12-15-11-4-2/h13,15H,3-12,14H2,1-2H3/t13-/m0/s1 |
| InChIKey | ACXSRBCTZAUPCG-ZDUSSCGKSA-N |
| XLogP | 3.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|