C13H27F3N2 — CID 115520367
2-methyl-1-N-(5,5,5-trifluoropentyl)heptane-1,6-diamine (PubChem CID 115520367) has the molecular formula C13H27F3N2 and a molecular weight of 268.37 g/mol. Its IUPAC name is 2-methyl-1-N-(5,5,5-trifluoropentyl)heptane-1,6-diamine.
| Compound Name | 2-methyl-1-N-(5,5,5-trifluoropentyl)heptane-1,6-diamine |
|---|---|
| PubChem CID | 115520367 |
| Molecular Formula | C13H27F3N2 |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.21 |
| IUPAC Name | 2-methyl-1-N-(5,5,5-trifluoropentyl)heptane-1,6-diamine |
| SMILES | CC(N)CCCC(C)CNCCCCC(F)(F)F |
| InChI | InChI=1S/C13H27F3N2/c1-11(6-5-7-12(2)17)10-18-9-4-3-8-13(14,15)16/h11-12,18H,3-10,17H2,1-2H3 |
| InChIKey | OFYMBTJALWVHBD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|