About tert-butyl (2R)-2-hydroxy-3-[3-(1,3-thiazol-4-yl)propanoylamino]propanoate
tert-butyl (2R)-2-hydroxy-3-[3-(1,3-thiazol-4-yl)propanoylamino]propanoate (PubChem CID 97254652) has the molecular formula C13H20N2O4S
and a molecular weight of 300.38 g/mol. Its IUPAC name is tert-butyl (2R)-2-hydroxy-3-[3-(1,3-thiazol-4-yl)propanoylamino]propanoate.
Molecular Properties
| Compound Name | tert-butyl (2R)-2-hydroxy-3-[3-(1,3-thiazol-4-yl)propanoylamino]propanoate |
| PubChem CID | 97254652 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | tert-butyl (2R)-2-hydroxy-3-[3-(1,3-thiazol-4-yl)propanoylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](O)CNC(=O)CCc1cscn1 |
| InChI | InChI=1S/C13H20N2O4S/c1-13(2,3)19-12(18)10(16)6-14-11(17)5-4-9-7-20-8-15-9/h7-8,10,16H,4-6H2,1-3H3,(H,14,17)/t10-/m1/s1 |
| InChIKey | NEUBSVNKCCBMKI-SNVBAGLBSA-N |
| XLogP | 0.89 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl (2R)-2-hydroxy-3-[3-(1,3-thiazol-4-yl)propanoylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R)-2-hydroxy-3-[3-(1,3-thiazol-4-yl)propanoylamino]propanoate?
The IUPAC name of tert-butyl (2R)-2-hydroxy-3-[3-(1,3-thiazol-4-yl)propanoylamino]propanoate (CID 97254652) is tert-butyl (2R)-2-hydroxy-3-[3-(1,3-thiazol-4-yl)propanoylamino]propanoate.
What is the SMILES notation for tert-butyl (2R)-2-hydroxy-3-[3-(1,3-thiazol-4-yl)propanoylamino]propanoate?
The canonical SMILES for tert-butyl (2R)-2-hydroxy-3-[3-(1,3-thiazol-4-yl)propanoylamino]propanoate is CC(C)(C)OC(=O)[C@H](O)CNC(=O)CCc1cscn1.
What is the InChIKey of tert-butyl (2R)-2-hydroxy-3-[3-(1,3-thiazol-4-yl)propanoylamino]propanoate?
The InChIKey is NEUBSVNKCCBMKI-SNVBAGLBSA-N. The full InChI is InChI=1S/C13H20N2O4S/c1-13(2,3)19-12(18)10(16)6-14-11(17)5-4-9-7-20-8-15-9/h7-8,10,16H,4-6H2,1-3H3,(H,14,17)/t10-/m1/s1.
What are the key properties of tert-butyl (2R)-2-hydroxy-3-[3-(1,3-thiazol-4-yl)propanoylamino]propanoate?
tert-butyl (2R)-2-hydroxy-3-[3-(1,3-thiazol-4-yl)propanoylamino]propanoate has a molecular weight of 300.38 g/mol, XLogP of 0.89, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R)-2-hydroxy-3-[3-(1,3-thiazol-4-yl)propanoylamino]propanoate is sourced from PubChem (CID 97254652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).