C12H18N2OS — CID 110679381
N-cyclohexyl-3-(1,3-thiazol-4-yl)propanamide (PubChem CID 110679381) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is N-cyclohexyl-3-(1,3-thiazol-4-yl)propanamide.
| Compound Name | N-cyclohexyl-3-(1,3-thiazol-4-yl)propanamide |
|---|---|
| PubChem CID | 110679381 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | N-cyclohexyl-3-(1,3-thiazol-4-yl)propanamide |
| SMILES | O=C(CCc1cscn1)NC1CCCCC1 |
| InChI | InChI=1S/C12H18N2OS/c15-12(7-6-11-8-16-9-13-11)14-10-4-2-1-3-5-10/h8-10H,1-7H2,(H,14,15) |
| InChIKey | FZRPXHMGSZOMCJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |