C12H11FN2OS — CID 110679486
N-(4-fluorophenyl)-3-(1,3-thiazol-4-yl)propanamide (PubChem CID 110679486) has the molecular formula C12H11FN2OS and a molecular weight of 250.30 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-(1,3-thiazol-4-yl)propanamide.
| Compound Name | N-(4-fluorophenyl)-3-(1,3-thiazol-4-yl)propanamide |
|---|---|
| PubChem CID | 110679486 |
| Molecular Formula | C12H11FN2OS |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | N-(4-fluorophenyl)-3-(1,3-thiazol-4-yl)propanamide |
| SMILES | O=C(CCc1cscn1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C12H11FN2OS/c13-9-1-3-10(4-2-9)15-12(16)6-5-11-7-17-8-14-11/h1-4,7-8H,5-6H2,(H,15,16) |
| InChIKey | LOHFYJJBEHCMQF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |