C21H17N3O3 — CID 113202428
3-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-(pyridin-2-ylmethyl)propanamide (PubChem CID 113202428) has the molecular formula C21H17N3O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is 3-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-(pyridin-2-ylmethyl)propanamide.
| Compound Name | 3-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-(pyridin-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 113202428 |
| Molecular Formula | C21H17N3O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 3-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-(pyridin-2-ylmethyl)propanamide |
| SMILES | O=C(CCN1C(=O)c2cccc3cccc(c23)C1=O)NCc1ccccn1 |
| InChI | InChI=1S/C21H17N3O3/c25-18(23-13-15-7-1-2-11-22-15)10-12-24-20(26)16-8-3-5-14-6-4-9-17(19(14)16)21(24)27/h1-9,11H,10,12-13H2,(H,23,25) |
| InChIKey | QURFNENONZMKEP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|