C19H13FN4O4 — CID 110318991
2-(1,3-dioxoisoindol-2-yl)-N-[[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]acetamide (PubChem CID 110318991) has the molecular formula C19H13FN4O4 and a molecular weight of 380.34 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 110318991 |
| Molecular Formula | C19H13FN4O4 |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)NCc1nnc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C19H13FN4O4/c20-14-8-4-3-7-13(14)17-23-22-16(28-17)9-21-15(25)10-24-18(26)11-5-1-2-6-12(11)19(24)27/h1-8H,9-10H2,(H,21,25) |
| InChIKey | PAMTVUCBAPHQJC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|