C16H12FN3O2 — CID 110318958
N-[[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]benzamide (PubChem CID 110318958) has the molecular formula C16H12FN3O2 and a molecular weight of 297.29 g/mol. Its IUPAC name is N-[[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]benzamide.
| Compound Name | N-[[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 110318958 |
| Molecular Formula | C16H12FN3O2 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | N-[[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]benzamide |
| SMILES | O=C(NCc1nnc(-c2ccccc2F)o1)c1ccccc1 |
| InChI | InChI=1S/C16H12FN3O2/c17-13-9-5-4-8-12(13)16-20-19-14(22-16)10-18-15(21)11-6-2-1-3-7-11/h1-9H,10H2,(H,18,21) |
| InChIKey | JPRZLQKUSSEPAU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |