C15H11FN4O2 — CID 110318527
2-fluoro-N-[(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)methyl]benzamide (PubChem CID 110318527) has the molecular formula C15H11FN4O2 and a molecular weight of 298.28 g/mol. Its IUPAC name is 2-fluoro-N-[(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)methyl]benzamide.
| Compound Name | 2-fluoro-N-[(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 110318527 |
| Molecular Formula | C15H11FN4O2 |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2-fluoro-N-[(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)methyl]benzamide |
| SMILES | O=C(NCc1nnc(-c2ccccn2)o1)c1ccccc1F |
| InChI | InChI=1S/C15H11FN4O2/c16-11-6-2-1-5-10(11)14(21)18-9-13-19-20-15(22-13)12-7-3-4-8-17-12/h1-8H,9H2,(H,18,21) |
| InChIKey | YBLXFLOLWSABTN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |