C19H17BrClN3O2S — CID 108770983
4-(4-bromo-2-chlorophenoxy)-N-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methyl]butanamide (PubChem CID 108770983) has the molecular formula C19H17BrClN3O2S and a molecular weight of 466.79 g/mol. Its IUPAC name is 4-(4-bromo-2-chlorophenoxy)-N-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methyl]butanamide.
| Compound Name | 4-(4-bromo-2-chlorophenoxy)-N-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methyl]butanamide |
|---|---|
| PubChem CID | 108770983 |
| Molecular Formula | C19H17BrClN3O2S |
| Molecular Weight | 466.79 g/mol |
| Exact Mass | 464.99 |
| IUPAC Name | 4-(4-bromo-2-chlorophenoxy)-N-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methyl]butanamide |
| SMILES | O=C(CCCOc1ccc(Br)cc1Cl)NCc1csc(-c2cccnc2)n1 |
| InChI | InChI=1S/C19H17BrClN3O2S/c20-14-5-6-17(16(21)9-14)26-8-2-4-18(25)23-11-15-12-27-19(24-15)13-3-1-7-22-10-13/h1,3,5-7,9-10,12H,2,4,8,11H2,(H,23,25) |
| InChIKey | PZRQYGZCEFEJRV-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.79 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|