C22H25N3O3S — CID 108771002
4-butoxy-3-ethoxy-N-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methyl]benzamide (PubChem CID 108771002) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is 4-butoxy-3-ethoxy-N-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methyl]benzamide.
| Compound Name | 4-butoxy-3-ethoxy-N-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 108771002 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 4-butoxy-3-ethoxy-N-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCc2csc(-c3cccnc3)n2)cc1OCC |
| InChI | InChI=1S/C22H25N3O3S/c1-3-5-11-28-19-9-8-16(12-20(19)27-4-2)21(26)24-14-18-15-29-22(25-18)17-7-6-10-23-13-17/h6-10,12-13,15H,3-5,11,14H2,1-2H3,(H,24,26) |
| InChIKey | VXCPKZFVLAVXIK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|