C18H22N2O5S — CID 119245284
2-[[(4-butoxy-3-ethoxybenzoyl)amino]methyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 119245284) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is 2-[[(4-butoxy-3-ethoxybenzoyl)amino]methyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[[(4-butoxy-3-ethoxybenzoyl)amino]methyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 119245284 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-[[(4-butoxy-3-ethoxybenzoyl)amino]methyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCCOc1ccc(C(=O)NCc2nc(C(=O)O)cs2)cc1OCC |
| InChI | InChI=1S/C18H22N2O5S/c1-3-5-8-25-14-7-6-12(9-15(14)24-4-2)17(21)19-10-16-20-13(11-26-16)18(22)23/h6-7,9,11H,3-5,8,10H2,1-2H3,(H,19,21)(H,22,23) |
| InChIKey | MLTJZRJIKMLJES-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|