C17H20N2O5S — CID 119245291
2-[[4-(4-ethoxyphenoxy)butanoylamino]methyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 119245291) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is 2-[[4-(4-ethoxyphenoxy)butanoylamino]methyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[[4-(4-ethoxyphenoxy)butanoylamino]methyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 119245291 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-[[4-(4-ethoxyphenoxy)butanoylamino]methyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CCOc1ccc(OCCCC(=O)NCc2nc(C(=O)O)cs2)cc1 |
| InChI | InChI=1S/C17H20N2O5S/c1-2-23-12-5-7-13(8-6-12)24-9-3-4-15(20)18-10-16-19-14(11-25-16)17(21)22/h5-8,11H,2-4,9-10H2,1H3,(H,18,20)(H,21,22) |
| InChIKey | BUJJUDWDXUCBPT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|